C15H24O4 — CID 146576482
[(4R)-3-hydroxy-4-methylcyclohexyl]methyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 146576482) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is [(4R)-3-hydroxy-4-methylcyclohexyl]methyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | [(4R)-3-hydroxy-4-methylcyclohexyl]methyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 146576482 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | [(4R)-3-hydroxy-4-methylcyclohexyl]methyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | C[C@@H]1CCC(COC(=O)C2CCC3OC3C2)CC1O |
| InChI | InChI=1S/C15H24O4/c1-9-2-3-10(6-12(9)16)8-18-15(17)11-4-5-13-14(7-11)19-13/h9-14,16H,2-8H2,1H3/t9-,10?,11?,12?,13?,14?/m1/s1 |
| InChIKey | GOWWSIYWCYNJDE-UIBFTYAWSA-N |
| XLogP | 1.89 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|