C16H28O4 — CID 142894147
ethane;(2-methyloxan-4-yl)methyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 142894147) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is ethane;(2-methyloxan-4-yl)methyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | ethane;(2-methyloxan-4-yl)methyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 142894147 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | ethane;(2-methyloxan-4-yl)methyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | CC.CC1CC(COC(=O)C2CCC3OC3C2)CCO1 |
| InChI | InChI=1S/C14H22O4.C2H6/c1-9-6-10(4-5-16-9)8-17-14(15)11-2-3-12-13(7-11)18-12;1-2/h9-13H,2-8H2,1H3;1-2H3 |
| InChIKey | DEECBOIITCKMED-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|