C20H32O6 — CID 156511246
5-O-[(2-methyloxan-4-yl)methyl] 1-O-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) 2-methylpentanedioate (PubChem CID 156511246) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is 5-O-[(2-methyloxan-4-yl)methyl] 1-O-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) 2-methylpentanedioate.
| Compound Name | 5-O-[(2-methyloxan-4-yl)methyl] 1-O-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) 2-methylpentanedioate |
|---|---|
| PubChem CID | 156511246 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 5-O-[(2-methyloxan-4-yl)methyl] 1-O-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) 2-methylpentanedioate |
| SMILES | CC1CC(COC(=O)CCC(C)C(=O)OCC2CCC3OC3C2)CCO1 |
| InChI | InChI=1S/C20H32O6/c1-13(20(22)25-12-15-4-5-17-18(10-15)26-17)3-6-19(21)24-11-16-7-8-23-14(2)9-16/h13-18H,3-12H2,1-2H3 |
| InChIKey | XIUHJYIXMWTNJA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|