C45H60O20 — CID 140922087
tetrakis[2-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)-2-oxoethyl] pentane-1,2,3,5-tetracarboxylate (PubChem CID 140922087) has the molecular formula C45H60O20 and a molecular weight of 920.95 g/mol. Its IUPAC name is tetrakis[2-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)-2-oxoethyl] pentane-1,2,3,5-tetracarboxylate.
| Compound Name | tetrakis[2-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)-2-oxoethyl] pentane-1,2,3,5-tetracarboxylate |
|---|---|
| PubChem CID | 140922087 |
| Molecular Formula | C45H60O20 |
| Molecular Weight | 920.95 g/mol |
| Exact Mass | 920.37 |
| IUPAC Name | tetrakis[2-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)-2-oxoethyl] pentane-1,2,3,5-tetracarboxylate |
| SMILES | O=C(CCC(C(=O)OCC(=O)OCC1CCC2OC2C1)C(CC(=O)OCC(=O)OCC1CCC2OC2C1)C(=O)OCC(=O)OCC1CCC2OC2C1)OCC(=O)OCC1CCC2OC2C1 |
| InChI | InChI=1S/C45H60O20/c46-38(58-20-40(48)54-16-24-1-6-30-34(11-24)62-30)10-5-28(44(52)60-22-42(50)56-18-26-3-8-32-36(13-26)64-32)29(45(53)61-23-43(51)57-19-27-4-9-33-37(14-27)65-33)15-39(47)59-21-41(49)55-17-25-2-7-31-35(12-25)63-31/h24-37H,1-23H2 |
| InChIKey | BEZNOXVDNZONCQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 260.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.95 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|