C17H22O8 — CID 162699890
[2-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)-2-oxoethyl] 3,4-diformyl-6-oxohexanoate (PubChem CID 162699890) has the molecular formula C17H22O8 and a molecular weight of 354.36 g/mol. Its IUPAC name is [2-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)-2-oxoethyl] 3,4-diformyl-6-oxohexanoate.
| Compound Name | [2-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)-2-oxoethyl] 3,4-diformyl-6-oxohexanoate |
|---|---|
| PubChem CID | 162699890 |
| Molecular Formula | C17H22O8 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | [2-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)-2-oxoethyl] 3,4-diformyl-6-oxohexanoate |
| SMILES | O=CCC(C=O)C(C=O)CC(=O)OCC(=O)OCC1CCC2OC2C1 |
| InChI | InChI=1S/C17H22O8/c18-4-3-12(7-19)13(8-20)6-16(21)24-10-17(22)23-9-11-1-2-14-15(5-11)25-14/h4,7-8,11-15H,1-3,5-6,9-10H2 |
| InChIKey | RVVBBOZZGJPOCQ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 116.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|