C15H26O3 — CID 145193402
7-oxabicyclo[4.1.0]heptan-3-ylmethyl 2,4,4-trimethylpentanoate (PubChem CID 145193402) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 2,4,4-trimethylpentanoate.
| Compound Name | 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 145193402 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 2,4,4-trimethylpentanoate |
| SMILES | CC(CC(C)(C)C)C(=O)OCC1CCC2OC2C1 |
| InChI | InChI=1S/C15H26O3/c1-10(8-15(2,3)4)14(16)17-9-11-5-6-12-13(7-11)18-12/h10-13H,5-9H2,1-4H3 |
| InChIKey | ZYAWEIGZMNJTKF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|