C16H28O3 — CID 118214259
7-oxabicyclo[4.1.0]heptan-3-ylmethyl 2,3,3-trimethylhexanoate (PubChem CID 118214259) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 2,3,3-trimethylhexanoate.
| Compound Name | 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 2,3,3-trimethylhexanoate |
|---|---|
| PubChem CID | 118214259 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 2,3,3-trimethylhexanoate |
| SMILES | CCCC(C)(C)C(C)C(=O)OCC1CCC2OC2C1 |
| InChI | InChI=1S/C16H28O3/c1-5-8-16(3,4)11(2)15(17)18-10-12-6-7-13-14(9-12)19-13/h11-14H,5-10H2,1-4H3 |
| InChIKey | NRQIVCQISLIJRI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|