C27H50O3 — CID 118214237
7-oxabicyclo[4.1.0]heptan-3-ylmethyl 10-methyl-2-(6-methylheptyl)undecanoate (PubChem CID 118214237) has the molecular formula C27H50O3 and a molecular weight of 422.69 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 10-methyl-2-(6-methylheptyl)undecanoate.
| Compound Name | 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 10-methyl-2-(6-methylheptyl)undecanoate |
|---|---|
| PubChem CID | 118214237 |
| Molecular Formula | C27H50O3 |
| Molecular Weight | 422.69 g/mol |
| Exact Mass | 422.38 |
| IUPAC Name | 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 10-methyl-2-(6-methylheptyl)undecanoate |
| SMILES | CC(C)CCCCCCCC(CCCCCC(C)C)C(=O)OCC1CCC2OC2C1 |
| InChI | InChI=1S/C27H50O3/c1-21(2)13-9-6-5-7-11-15-24(16-12-8-10-14-22(3)4)27(28)29-20-23-17-18-25-26(19-23)30-25/h21-26H,5-20H2,1-4H3 |
| InChIKey | YBVBCKWEWQWVGY-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.69 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|