C22H32O5 — CID 135213447
[5-(2-methylprop-2-enoyloxy)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]methyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 135213447) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is [5-(2-methylprop-2-enoyloxy)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]methyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | [5-(2-methylprop-2-enoyloxy)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]methyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 135213447 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [5-(2-methylprop-2-enoyloxy)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]methyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | C=C(C)C(=O)OC1CCCC2CC(COC(=O)C3CCC4OC4C3)CCC21 |
| InChI | InChI=1S/C22H32O5/c1-13(2)21(23)27-18-5-3-4-15-10-14(6-8-17(15)18)12-25-22(24)16-7-9-19-20(11-16)26-19/h14-20H,1,3-12H2,2H3 |
| InChIKey | JRCRBIYSSGYYBA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|