C18H28O8 — CID 101149917
(3-acetyloxy-4-hydroxycyclohexyl)methyl 3-acetyloxy-4-hydroxycyclohexane-1-carboxylate (PubChem CID 101149917) has the molecular formula C18H28O8 and a molecular weight of 372.41 g/mol. Its IUPAC name is (3-acetyloxy-4-hydroxycyclohexyl)methyl 3-acetyloxy-4-hydroxycyclohexane-1-carboxylate.
| Compound Name | (3-acetyloxy-4-hydroxycyclohexyl)methyl 3-acetyloxy-4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 101149917 |
| Molecular Formula | C18H28O8 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (3-acetyloxy-4-hydroxycyclohexyl)methyl 3-acetyloxy-4-hydroxycyclohexane-1-carboxylate |
| SMILES | CC(=O)OC1CC(COC(=O)C2CCC(O)C(OC(C)=O)C2)CCC1O |
| InChI | InChI=1S/C18H28O8/c1-10(19)25-16-7-12(3-5-14(16)21)9-24-18(23)13-4-6-15(22)17(8-13)26-11(2)20/h12-17,21-22H,3-9H2,1-2H3 |
| InChIKey | QWXFSEIKSHSRDY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|