C7HF13O — CID 139188899
2,2,3,3,4,4,5,5,6,6-decafluoro-1-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 139188899) has the molecular formula C7HF13O and a molecular weight of 348.06 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 139188899 |
| Molecular Formula | C7HF13O |
| Molecular Weight | 348.06 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | OC1(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7HF13O/c8-2(9)1(21,7(18,19)20)3(10,11)5(14,15)6(16,17)4(2,12)13/h21H |
| InChIKey | HVMHNJKTVPIBCX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.06 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|