C12H12O7 — CID 140812243
[2-methyl-3,3-di(prop-2-enoyloxy)oxiran-2-yl] prop-2-enoate (PubChem CID 140812243) has the molecular formula C12H12O7 and a molecular weight of 268.22 g/mol. Its IUPAC name is [2-methyl-3,3-di(prop-2-enoyloxy)oxiran-2-yl] prop-2-enoate.
| Compound Name | [2-methyl-3,3-di(prop-2-enoyloxy)oxiran-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 140812243 |
| Molecular Formula | C12H12O7 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | [2-methyl-3,3-di(prop-2-enoyloxy)oxiran-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC1(C)OC1(OC(=O)C=C)OC(=O)C=C |
| InChI | InChI=1S/C12H12O7/c1-5-8(13)16-11(4)12(19-11,17-9(14)6-2)18-10(15)7-3/h5-7H,1-3H2,4H3 |
| InChIKey | GHSHPYANOWNBGD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|