C19H10F12O7 — CID 89354552
[2,2,4,4,6,6,8,8,9,9,10,10-dodecafluoro-3-hydroxy-5,7-di(prop-2-enoyloxy)-1-adamantyl] prop-2-enoate (PubChem CID 89354552) has the molecular formula C19H10F12O7 and a molecular weight of 578.26 g/mol. Its IUPAC name is [2,2,4,4,6,6,8,8,9,9,10,10-dodecafluoro-3-hydroxy-5,7-di(prop-2-enoyloxy)-1-adamantyl] prop-2-enoate.
| Compound Name | [2,2,4,4,6,6,8,8,9,9,10,10-dodecafluoro-3-hydroxy-5,7-di(prop-2-enoyloxy)-1-adamantyl] prop-2-enoate |
|---|---|
| PubChem CID | 89354552 |
| Molecular Formula | C19H10F12O7 |
| Molecular Weight | 578.26 g/mol |
| Exact Mass | 578.02 |
| IUPAC Name | [2,2,4,4,6,6,8,8,9,9,10,10-dodecafluoro-3-hydroxy-5,7-di(prop-2-enoyloxy)-1-adamantyl] prop-2-enoate |
| SMILES | C=CC(=O)OC12C(F)(F)C3(O)C(F)(F)C(OC(=O)C=C)(C1(F)F)C(F)(F)C(OC(=O)C=C)(C3(F)F)C2(F)F |
| InChI | InChI=1S/C19H10F12O7/c1-4-7(32)36-11-14(20,21)10(35)15(22,23)12(17(11,26)27,37-8(33)5-2)19(30,31)13(16(10,24)25,18(11,28)29)38-9(34)6-3/h4-6,35H,1-3H2 |
| InChIKey | ZPWIQARLLDRVMD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|