C16H11F11O5 — CID 140514702
[2,2,3,4,4,6,6,7,9,9-decafluoro-3-(fluoromethyl)-5-hydroxy-7-prop-2-enoyloxy-1-bicyclo[3.3.1]nonanyl] prop-2-enoate (PubChem CID 140514702) has the molecular formula C16H11F11O5 and a molecular weight of 492.24 g/mol. Its IUPAC name is [2,2,3,4,4,6,6,7,9,9-decafluoro-3-(fluoromethyl)-5-hydroxy-7-prop-2-enoyloxy-1-bicyclo[3.3.1]nonanyl] prop-2-enoate.
| Compound Name | [2,2,3,4,4,6,6,7,9,9-decafluoro-3-(fluoromethyl)-5-hydroxy-7-prop-2-enoyloxy-1-bicyclo[3.3.1]nonanyl] prop-2-enoate |
|---|---|
| PubChem CID | 140514702 |
| Molecular Formula | C16H11F11O5 |
| Molecular Weight | 492.24 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | [2,2,3,4,4,6,6,7,9,9-decafluoro-3-(fluoromethyl)-5-hydroxy-7-prop-2-enoyloxy-1-bicyclo[3.3.1]nonanyl] prop-2-enoate |
| SMILES | C=CC(=O)OC1(F)CC2(OC(=O)C=C)C(F)(F)C(F)(CF)C(F)(F)C(O)(C1(F)F)C2(F)F |
| InChI | InChI=1S/C16H11F11O5/c1-3-7(28)31-10-5-11(19,32-8(29)4-2)16(26,27)12(30,15(10,24)25)14(22,23)9(18,6-17)13(10,20)21/h3-4,30H,1-2,5-6H2 |
| InChIKey | YQSGULKKDOZEFC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|