C17H26O3 — CID 58013619
(3-ethoxy-5,7-dimethyl-1-adamantyl) prop-2-enoate (PubChem CID 58013619) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (3-ethoxy-5,7-dimethyl-1-adamantyl) prop-2-enoate.
| Compound Name | (3-ethoxy-5,7-dimethyl-1-adamantyl) prop-2-enoate |
|---|---|
| PubChem CID | 58013619 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (3-ethoxy-5,7-dimethyl-1-adamantyl) prop-2-enoate |
| SMILES | C=CC(=O)OC12CC3(C)CC(C)(CC(OCC)(C3)C1)C2 |
| InChI | InChI=1S/C17H26O3/c1-5-13(18)20-17-10-14(3)7-15(4,11-17)9-16(8-14,12-17)19-6-2/h5H,1,6-12H2,2-4H3 |
| InChIKey | PMGIGBFDXXFWIO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|