C13H12F12O2 — CID 91583217
[3,3,4,4,6,6,7,9,9-nonafluoro-7-(fluoromethyl)-1-bicyclo[3.3.1]nonanyl] prop-2-enoate;dihydrofluoride (PubChem CID 91583217) has the molecular formula C13H12F12O2 and a molecular weight of 428.21 g/mol. Its IUPAC name is [3,3,4,4,6,6,7,9,9-nonafluoro-7-(fluoromethyl)-1-bicyclo[3.3.1]nonanyl] prop-2-enoate;dihydrofluoride.
| Compound Name | [3,3,4,4,6,6,7,9,9-nonafluoro-7-(fluoromethyl)-1-bicyclo[3.3.1]nonanyl] prop-2-enoate;dihydrofluoride |
|---|---|
| PubChem CID | 91583217 |
| Molecular Formula | C13H12F12O2 |
| Molecular Weight | 428.21 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | [3,3,4,4,6,6,7,9,9-nonafluoro-7-(fluoromethyl)-1-bicyclo[3.3.1]nonanyl] prop-2-enoate;dihydrofluoride |
| SMILES | C=CC(=O)OC12CC(F)(F)C(F)(F)C(C(F)(F)C(F)(CF)C1)C2(F)F.F.F |
| InChI | InChI=1S/C13H10F10O2.2FH/c1-2-6(24)25-9-3-8(15,5-14)11(18,19)7(12(9,20)21)13(22,23)10(16,17)4-9;;/h2,7H,1,3-5H2;2*1H |
| InChIKey | TVJFKFTUGHJSLI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.21 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|