C19H13F11O6 — CID 140514705
[2,2,3,4,4,6,6,7,9,9-decafluoro-3-(fluoromethyl)-5,7-di(prop-2-enoyloxy)-1-bicyclo[3.3.1]nonanyl] prop-2-enoate (PubChem CID 140514705) has the molecular formula C19H13F11O6 and a molecular weight of 546.29 g/mol. Its IUPAC name is [2,2,3,4,4,6,6,7,9,9-decafluoro-3-(fluoromethyl)-5,7-di(prop-2-enoyloxy)-1-bicyclo[3.3.1]nonanyl] prop-2-enoate.
| Compound Name | [2,2,3,4,4,6,6,7,9,9-decafluoro-3-(fluoromethyl)-5,7-di(prop-2-enoyloxy)-1-bicyclo[3.3.1]nonanyl] prop-2-enoate |
|---|---|
| PubChem CID | 140514705 |
| Molecular Formula | C19H13F11O6 |
| Molecular Weight | 546.29 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | [2,2,3,4,4,6,6,7,9,9-decafluoro-3-(fluoromethyl)-5,7-di(prop-2-enoyloxy)-1-bicyclo[3.3.1]nonanyl] prop-2-enoate |
| SMILES | C=CC(=O)OC1(F)CC2(OC(=O)C=C)C(F)(F)C(F)(CF)C(F)(F)C(OC(=O)C=C)(C1(F)F)C2(F)F |
| InChI | InChI=1S/C19H13F11O6/c1-4-9(31)34-13-7-14(22,35-10(32)5-2)19(29,30)15(18(13,27)28,36-11(33)6-3)17(25,26)12(21,8-20)16(13,23)24/h4-6H,1-3,7-8H2 |
| InChIKey | HNWIQOFAPKJDKK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|