C19H12F12O7 — CID 140514714
[2,2,3,4,4,6,6,8,8,9,9-undecafluoro-7-(fluoromethyl)-7-hydroxy-3,5-di(prop-2-enoyloxy)-1-bicyclo[3.3.1]nonanyl] prop-2-enoate (PubChem CID 140514714) has the molecular formula C19H12F12O7 and a molecular weight of 580.27 g/mol. Its IUPAC name is [2,2,3,4,4,6,6,8,8,9,9-undecafluoro-7-(fluoromethyl)-7-hydroxy-3,5-di(prop-2-enoyloxy)-1-bicyclo[3.3.1]nonanyl] prop-2-enoate.
| Compound Name | [2,2,3,4,4,6,6,8,8,9,9-undecafluoro-7-(fluoromethyl)-7-hydroxy-3,5-di(prop-2-enoyloxy)-1-bicyclo[3.3.1]nonanyl] prop-2-enoate |
|---|---|
| PubChem CID | 140514714 |
| Molecular Formula | C19H12F12O7 |
| Molecular Weight | 580.27 g/mol |
| Exact Mass | 580.04 |
| IUPAC Name | [2,2,3,4,4,6,6,8,8,9,9-undecafluoro-7-(fluoromethyl)-7-hydroxy-3,5-di(prop-2-enoyloxy)-1-bicyclo[3.3.1]nonanyl] prop-2-enoate |
| SMILES | C=CC(=O)OC1(F)C(F)(F)C2(OC(=O)C=C)C(F)(F)C(O)(CF)C(F)(F)C(OC(=O)C=C)(C1(F)F)C2(F)F |
| InChI | InChI=1S/C19H12F12O7/c1-4-8(32)36-12-14(21,22)11(35,7-20)15(23,24)13(16(12,25)26,37-9(33)5-2)18(29,30)19(31,17(12,27)28)38-10(34)6-3/h4-6,35H,1-3,7H2 |
| InChIKey | NKTXNMLOSMFSAG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|