C13H22O4 — CID 141037725
(1-tert-butyl-2,5-dihydroxycyclopentyl)methyl prop-2-enoate (PubChem CID 141037725) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (1-tert-butyl-2,5-dihydroxycyclopentyl)methyl prop-2-enoate.
| Compound Name | (1-tert-butyl-2,5-dihydroxycyclopentyl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 141037725 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (1-tert-butyl-2,5-dihydroxycyclopentyl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1(C(C)(C)C)C(O)CCC1O |
| InChI | InChI=1S/C13H22O4/c1-5-11(16)17-8-13(12(2,3)4)9(14)6-7-10(13)15/h5,9-10,14-15H,1,6-8H2,2-4H3 |
| InChIKey | QFUFBWMBQJBMTD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|