C36H54O12 — CID 70541878
1,3,5-tris(6-prop-2-enoyloxyhexyl)cyclohexane-1,3,5-tricarboxylic acid (PubChem CID 70541878) has the molecular formula C36H54O12 and a molecular weight of 678.82 g/mol. Its IUPAC name is 1,3,5-tris(6-prop-2-enoyloxyhexyl)cyclohexane-1,3,5-tricarboxylic acid.
| Compound Name | 1,3,5-tris(6-prop-2-enoyloxyhexyl)cyclohexane-1,3,5-tricarboxylic acid |
|---|---|
| PubChem CID | 70541878 |
| Molecular Formula | C36H54O12 |
| Molecular Weight | 678.82 g/mol |
| Exact Mass | 678.36 |
| IUPAC Name | 1,3,5-tris(6-prop-2-enoyloxyhexyl)cyclohexane-1,3,5-tricarboxylic acid |
| SMILES | C=CC(=O)OCCCCCCC1(C(=O)O)CC(CCCCCCOC(=O)C=C)(C(=O)O)CC(CCCCCCOC(=O)C=C)(C(=O)O)C1 |
| InChI | InChI=1S/C36H54O12/c1-4-28(37)46-22-16-10-7-13-19-34(31(40)41)25-35(32(42)43,20-14-8-11-17-23-47-29(38)5-2)27-36(26-34,33(44)45)21-15-9-12-18-24-48-30(39)6-3/h4-6H,1-3,7-27H2,(H,40,41)(H,42,43)(H,44,45) |
| InChIKey | GHYSYRNFWYRNQN-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 190.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.82 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|