C11H16O5S — CID 129390363
[2-[[(2R,6S)-6-methyl-1,4-oxathian-2-yl]oxy]-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 129390363) has the molecular formula C11H16O5S and a molecular weight of 260.31 g/mol. Its IUPAC name is [2-[[(2R,6S)-6-methyl-1,4-oxathian-2-yl]oxy]-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[(2R,6S)-6-methyl-1,4-oxathian-2-yl]oxy]-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129390363 |
| Molecular Formula | C11H16O5S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | [2-[[(2R,6S)-6-methyl-1,4-oxathian-2-yl]oxy]-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)O[C@@H]1CSC[C@H](C)O1 |
| InChI | InChI=1S/C11H16O5S/c1-7(2)11(13)14-4-9(12)16-10-6-17-5-8(3)15-10/h8,10H,1,4-6H2,2-3H3/t8-,10+/m0/s1 |
| InChIKey | IEJJMZGLCQZBQN-WCBMZHEXSA-N |
| XLogP | 1.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|