C13H18O8S — CID 129190027
[2-[(6-methyl-5-sulfinooxy-7-oxabicyclo[2.2.1]heptan-2-yl)oxy]-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 129190027) has the molecular formula C13H18O8S and a molecular weight of 334.35 g/mol. Its IUPAC name is [2-[(6-methyl-5-sulfinooxy-7-oxabicyclo[2.2.1]heptan-2-yl)oxy]-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[(6-methyl-5-sulfinooxy-7-oxabicyclo[2.2.1]heptan-2-yl)oxy]-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129190027 |
| Molecular Formula | C13H18O8S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | [2-[(6-methyl-5-sulfinooxy-7-oxabicyclo[2.2.1]heptan-2-yl)oxy]-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC1CC2OC1C(C)C2OS(=O)O |
| InChI | InChI=1S/C13H18O8S/c1-6(2)13(15)18-5-10(14)19-8-4-9-12(21-22(16)17)7(3)11(8)20-9/h7-9,11-12H,1,4-5H2,2-3H3,(H,16,17) |
| InChIKey | ODKHJOGDPGKUDE-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|