C17H10F18O6 — CID 57178125
tris(1,1,1,3,3,3-hexafluoropropan-2-yl) pent-4-ene-1,2,4-tricarboxylate (PubChem CID 57178125) has the molecular formula C17H10F18O6 and a molecular weight of 652.22 g/mol. Its IUPAC name is tris(1,1,1,3,3,3-hexafluoropropan-2-yl) pent-4-ene-1,2,4-tricarboxylate.
| Compound Name | tris(1,1,1,3,3,3-hexafluoropropan-2-yl) pent-4-ene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 57178125 |
| Molecular Formula | C17H10F18O6 |
| Molecular Weight | 652.22 g/mol |
| Exact Mass | 652.02 |
| IUPAC Name | tris(1,1,1,3,3,3-hexafluoropropan-2-yl) pent-4-ene-1,2,4-tricarboxylate |
| SMILES | C=C(CC(CC(=O)OC(C(F)(F)F)C(F)(F)F)C(=O)OC(C(F)(F)F)C(F)(F)F)C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H10F18O6/c1-4(7(37)40-10(14(24,25)26)15(27,28)29)2-5(8(38)41-11(16(30,31)32)17(33,34)35)3-6(36)39-9(12(18,19)20)13(21,22)23/h5,9-11H,1-3H2 |
| InChIKey | COPLENNGXGFVQF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.22 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|