C20H15F19O6 — CID 54574502
1-O,2-O-bis(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-(2,2,2-trifluoroethyl) pent-4-ene-1,2,4-tricarboxylate (PubChem CID 54574502) has the molecular formula C20H15F19O6 and a molecular weight of 712.30 g/mol. Its IUPAC name is 1-O,2-O-bis(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-(2,2,2-trifluoroethyl) pent-4-ene-1,2,4-tricarboxylate.
| Compound Name | 1-O,2-O-bis(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-(2,2,2-trifluoroethyl) pent-4-ene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 54574502 |
| Molecular Formula | C20H15F19O6 |
| Molecular Weight | 712.30 g/mol |
| Exact Mass | 712.06 |
| IUPAC Name | 1-O,2-O-bis(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-(2,2,2-trifluoroethyl) pent-4-ene-1,2,4-tricarboxylate |
| SMILES | C=C(CC(CC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C20H15F19O6/c1-7(10(41)45-6-16(29,30)31)2-8(11(42)44-5-15(27,28)20(38,39)18(34,35)13(23)24)3-9(40)43-4-14(25,26)19(36,37)17(32,33)12(21)22/h8,12-13H,1-6H2 |
| InChIKey | ZZPKIMXVYOWFCW-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.30 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|