C7H9F7NO5S3- — CID 123874474
1,1,2,2,3,3-hexafluoro-3-[(2-fluoropropan-2-yl-methylidene-oxo-λ6-sulfanyl)sulfamoyl]propane-1-sulfinate (PubChem CID 123874474) has the molecular formula C7H9F7NO5S3- and a molecular weight of 416.34 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[(2-fluoropropan-2-yl-methylidene-oxo-λ6-sulfanyl)sulfamoyl]propane-1-sulfinate.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[(2-fluoropropan-2-yl-methylidene-oxo-λ6-sulfanyl)sulfamoyl]propane-1-sulfinate |
|---|---|
| PubChem CID | 123874474 |
| Molecular Formula | C7H9F7NO5S3- |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 415.95 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[(2-fluoropropan-2-yl-methylidene-oxo-λ6-sulfanyl)sulfamoyl]propane-1-sulfinate |
| SMILES | C=S(=O)(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)[O-])C(C)(C)F |
| InChI | InChI=1S/C7H10F7NO5S3/c1-4(2,8)22(3,18)15-23(19,20)7(13,14)5(9,10)6(11,12)21(16)17/h3H2,1-2H3,(H,15,18)(H,16,17)/p-1 |
| InChIKey | PPIHWFDLRXDVIM-UHFFFAOYSA-M |
| XLogP | 0.94 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|