C6H16F4N2O11S5 — CID 161262856
methanesulfonic acid;N-methylsulfonylmethanesulfonamide;N-(1,1,3-trifluoropropylsulfonyl)sulfamoyl fluoride (PubChem CID 161262856) has the molecular formula C6H16F4N2O11S5 and a molecular weight of 528.52 g/mol. Its IUPAC name is methanesulfonic acid;N-methylsulfonylmethanesulfonamide;N-(1,1,3-trifluoropropylsulfonyl)sulfamoyl fluoride.
| Compound Name | methanesulfonic acid;N-methylsulfonylmethanesulfonamide;N-(1,1,3-trifluoropropylsulfonyl)sulfamoyl fluoride |
|---|---|
| PubChem CID | 161262856 |
| Molecular Formula | C6H16F4N2O11S5 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 527.93 |
| IUPAC Name | methanesulfonic acid;N-methylsulfonylmethanesulfonamide;N-(1,1,3-trifluoropropylsulfonyl)sulfamoyl fluoride |
| SMILES | CS(=O)(=O)NS(C)(=O)=O.CS(=O)(=O)O.O=S(=O)(F)NS(=O)(=O)C(F)(F)CCF |
| InChI | InChI=1S/C3H5F4NO4S2.C2H7NO4S2.CH4O3S/c4-2-1-3(5,6)13(9,10)8-14(7,11)12;1-8(4,5)3-9(2,6)7;1-5(2,3)4/h8H,1-2H2;3H,1-2H3;1H3,(H,2,3,4) |
| InChIKey | NGICNHUGTAJNPD-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 214.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|