C6H10F6N2O4S2 — CID 118659621
N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride;pyrrolidine (PubChem CID 118659621) has the molecular formula C6H10F6N2O4S2 and a molecular weight of 352.28 g/mol. Its IUPAC name is N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride;pyrrolidine.
| Compound Name | N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride;pyrrolidine |
|---|---|
| PubChem CID | 118659621 |
| Molecular Formula | C6H10F6N2O4S2 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride;pyrrolidine |
| SMILES | C1CCNC1.O=S(=O)(F)NS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H9N.C2HF6NO4S2/c1-2-4-5-3-1;3-1(4,5)2(6,7)14(10,11)9-15(8,12)13/h5H,1-4H2;9H |
| InChIKey | NTXLZRXPHOORNJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|