About N-fluorosulfonylsulfamoyl fluoride;morpholine
N-fluorosulfonylsulfamoyl fluoride;morpholine (PubChem CID 118659698) has the molecular formula C4H10F2N2O5S2
and a molecular weight of 268.26 g/mol. Its IUPAC name is N-fluorosulfonylsulfamoyl fluoride;morpholine.
Molecular Properties
| Compound Name | N-fluorosulfonylsulfamoyl fluoride;morpholine |
| PubChem CID | 118659698 |
| Molecular Formula | C4H10F2N2O5S2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | N-fluorosulfonylsulfamoyl fluoride;morpholine |
| SMILES | C1COCCN1.O=S(=O)(F)NS(=O)(=O)F |
| InChI | InChI=1S/C4H9NO.F2HNO4S2/c1-3-6-4-2-5-1;1-8(4,5)3-9(2,6)7/h5H,1-4H2;3H |
| InChIKey | QXESOJYMYAQAAC-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-fluorosulfonylsulfamoyl fluoride;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-fluorosulfonylsulfamoyl fluoride;morpholine?
The IUPAC name of N-fluorosulfonylsulfamoyl fluoride;morpholine (CID 118659698) is N-fluorosulfonylsulfamoyl fluoride;morpholine.
What is the SMILES notation for N-fluorosulfonylsulfamoyl fluoride;morpholine?
The canonical SMILES for N-fluorosulfonylsulfamoyl fluoride;morpholine is C1COCCN1.O=S(=O)(F)NS(=O)(=O)F.
What is the InChIKey of N-fluorosulfonylsulfamoyl fluoride;morpholine?
The InChIKey is QXESOJYMYAQAAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.F2HNO4S2/c1-3-6-4-2-5-1;1-8(4,5)3-9(2,6)7/h5H,1-4H2;3H.
What are the key properties of N-fluorosulfonylsulfamoyl fluoride;morpholine?
N-fluorosulfonylsulfamoyl fluoride;morpholine has a molecular weight of 268.26 g/mol, XLogP of -1.39, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-fluorosulfonylsulfamoyl fluoride;morpholine is sourced from PubChem (CID 118659698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).