C8H4F12O3S — CID 165364863
(Z)-3,4,4,5,5,6,6,7,7,8,8,8-dodecafluorooct-2-ene-1-sulfonic acid (PubChem CID 165364863) has the molecular formula C8H4F12O3S and a molecular weight of 408.16 g/mol. Its IUPAC name is (Z)-3,4,4,5,5,6,6,7,7,8,8,8-dodecafluorooct-2-ene-1-sulfonic acid.
| Compound Name | (Z)-3,4,4,5,5,6,6,7,7,8,8,8-dodecafluorooct-2-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 165364863 |
| Molecular Formula | C8H4F12O3S |
| Molecular Weight | 408.16 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | (Z)-3,4,4,5,5,6,6,7,7,8,8,8-dodecafluorooct-2-ene-1-sulfonic acid |
| SMILES | O=S(=O)(O)C/C=C(\F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H4F12O3S/c9-3(1-2-24(21,22)23)4(10,11)5(12,13)6(14,15)7(16,17)8(18,19)20/h1H,2H2,(H,21,22,23)/b3-1- |
| InChIKey | IJCUQFKFGMUYCA-IWQZZHSRSA-N |
| XLogP | 3.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.16 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|