C7H2F12O — CID 175056304
1,3,3,4,4,5,5,6,6,7,7,7-dodecafluoroheptan-2-one (PubChem CID 175056304) has the molecular formula C7H2F12O and a molecular weight of 330.07 g/mol. Its IUPAC name is 1,3,3,4,4,5,5,6,6,7,7,7-dodecafluoroheptan-2-one.
| Compound Name | 1,3,3,4,4,5,5,6,6,7,7,7-dodecafluoroheptan-2-one |
|---|---|
| PubChem CID | 175056304 |
| Molecular Formula | C7H2F12O |
| Molecular Weight | 330.07 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 1,3,3,4,4,5,5,6,6,7,7,7-dodecafluoroheptan-2-one |
| SMILES | O=C(CF)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H2F12O/c8-1-2(20)3(9,10)4(11,12)5(13,14)6(15,16)7(17,18)19/h1H2 |
| InChIKey | OLGXIIJIYGXSEV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.07 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|