C5F12O2S — CID 22105014
1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2,2-pentafluoroethylsulfonyl)propane (PubChem CID 22105014) has the molecular formula C5F12O2S and a molecular weight of 352.10 g/mol. Its IUPAC name is 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2,2-pentafluoroethylsulfonyl)propane.
| Compound Name | 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2,2-pentafluoroethylsulfonyl)propane |
|---|---|
| PubChem CID | 22105014 |
| Molecular Formula | C5F12O2S |
| Molecular Weight | 352.10 g/mol |
| Exact Mass | 351.94 |
| IUPAC Name | 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2,2-pentafluoroethylsulfonyl)propane |
| SMILES | O=S(=O)(C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5F12O2S/c6-1(2(7,8)9,3(10,11)12)20(18,19)5(16,17)4(13,14)15 |
| InChIKey | AQXZCGKOCSKMBU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.10 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|