C3HF7NO2S- — CID 154269472
1,1,2,2,3,3,3-heptafluoropropylsulfonylazanide (PubChem CID 154269472) has the molecular formula C3HF7NO2S- and a molecular weight of 248.10 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoropropylsulfonylazanide.
| Compound Name | 1,1,2,2,3,3,3-heptafluoropropylsulfonylazanide |
|---|---|
| PubChem CID | 154269472 |
| Molecular Formula | C3HF7NO2S- |
| Molecular Weight | 248.10 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoropropylsulfonylazanide |
| SMILES | [NH-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C3HF7NO2S/c4-1(5,2(6,7)8)3(9,10)14(11,12)13/h(H-,11,12,13)/q-1 |
| InChIKey | SFDGFQIPCYJRDB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 57.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.10 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|