C4H5F9N2O2S — CID 170852078
azane;(1,1,2,2,3,3,4,4,4-nonafluorobutyl-oxo-oxoniumylidene-λ6-sulfanyl)azanide (PubChem CID 170852078) has the molecular formula C4H5F9N2O2S and a molecular weight of 316.15 g/mol. Its IUPAC name is azane;(1,1,2,2,3,3,4,4,4-nonafluorobutyl-oxo-oxoniumylidene-λ6-sulfanyl)azanide.
| Compound Name | azane;(1,1,2,2,3,3,4,4,4-nonafluorobutyl-oxo-oxoniumylidene-λ6-sulfanyl)azanide |
|---|---|
| PubChem CID | 170852078 |
| Molecular Formula | C4H5F9N2O2S |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | azane;(1,1,2,2,3,3,4,4,4-nonafluorobutyl-oxo-oxoniumylidene-λ6-sulfanyl)azanide |
| SMILES | N.[H][O+]=S([NH-])(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4HF9NO2S.H3N/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16;/h(H-,14,15,16);1H3/q-1;/p+1 |
| InChIKey | JYKFXMBPZUQFSM-UHFFFAOYSA-O |
| XLogP | 3.11 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|