About butyl(trimethyl)azanium;phosphoric acid
butyl(trimethyl)azanium;phosphoric acid (PubChem CID 175165471) has the molecular formula C7H21NO4P+
and a molecular weight of 214.22 g/mol. Its IUPAC name is butyl(trimethyl)azanium;phosphoric acid.
Molecular Properties
| Compound Name | butyl(trimethyl)azanium;phosphoric acid |
| PubChem CID | 175165471 |
| Molecular Formula | C7H21NO4P+ |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | butyl(trimethyl)azanium;phosphoric acid |
| SMILES | CCCC[N+](C)(C)C.O=P(O)(O)O |
| InChI | InChI=1S/C7H18N.H3O4P/c1-5-6-7-8(2,3)4;1-5(2,3)4/h5-7H2,1-4H3;(H3,1,2,3,4)/q+1; |
| InChIKey | SGLCJXDUFDELEW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butyl(trimethyl)azanium;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(trimethyl)azanium;phosphoric acid?
The IUPAC name of butyl(trimethyl)azanium;phosphoric acid (CID 175165471) is butyl(trimethyl)azanium;phosphoric acid.
What is the SMILES notation for butyl(trimethyl)azanium;phosphoric acid?
The canonical SMILES for butyl(trimethyl)azanium;phosphoric acid is CCCC[N+](C)(C)C.O=P(O)(O)O.
What is the InChIKey of butyl(trimethyl)azanium;phosphoric acid?
The InChIKey is SGLCJXDUFDELEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N.H3O4P/c1-5-6-7-8(2,3)4;1-5(2,3)4/h5-7H2,1-4H3;(H3,1,2,3,4)/q+1;.
What are the key properties of butyl(trimethyl)azanium;phosphoric acid?
butyl(trimethyl)azanium;phosphoric acid has a molecular weight of 214.22 g/mol, XLogP of 0.56, 3 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(trimethyl)azanium;phosphoric acid is sourced from PubChem (CID 175165471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).