About N-fluorosulfonylsulfamoyl fluoride;methyl(trioctyl)azanium
N-fluorosulfonylsulfamoyl fluoride;methyl(trioctyl)azanium (PubChem CID 175511644) has the molecular formula C25H55F2N2O4S2+
and a molecular weight of 549.86 g/mol. Its IUPAC name is N-fluorosulfonylsulfamoyl fluoride;methyl(trioctyl)azanium.
Molecular Properties
| Compound Name | N-fluorosulfonylsulfamoyl fluoride;methyl(trioctyl)azanium |
| PubChem CID | 175511644 |
| Molecular Formula | C25H55F2N2O4S2+ |
| Molecular Weight | 549.86 g/mol |
| Exact Mass | 549.36 |
| IUPAC Name | N-fluorosulfonylsulfamoyl fluoride;methyl(trioctyl)azanium |
| SMILES | CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC.O=S(=O)(F)NS(=O)(=O)F |
| InChI | InChI=1S/C25H54N.F2HNO4S2/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;1-8(4,5)3-9(2,6)7/h5-25H2,1-4H3;3H/q+1; |
| InChIKey | VQUTWEVYBBKYOG-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 549.86 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N-fluorosulfonylsulfamoyl fluoride;methyl(trioctyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-fluorosulfonylsulfamoyl fluoride;methyl(trioctyl)azanium?
The IUPAC name of N-fluorosulfonylsulfamoyl fluoride;methyl(trioctyl)azanium (CID 175511644) is N-fluorosulfonylsulfamoyl fluoride;methyl(trioctyl)azanium.
What is the SMILES notation for N-fluorosulfonylsulfamoyl fluoride;methyl(trioctyl)azanium?
The canonical SMILES for N-fluorosulfonylsulfamoyl fluoride;methyl(trioctyl)azanium is CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC.O=S(=O)(F)NS(=O)(=O)F.
What is the InChIKey of N-fluorosulfonylsulfamoyl fluoride;methyl(trioctyl)azanium?
The InChIKey is VQUTWEVYBBKYOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H54N.F2HNO4S2/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;1-8(4,5)3-9(2,6)7/h5-25H2,1-4H3;3H/q+1;.
What are the key properties of N-fluorosulfonylsulfamoyl fluoride;methyl(trioctyl)azanium?
N-fluorosulfonylsulfamoyl fluoride;methyl(trioctyl)azanium has a molecular weight of 549.86 g/mol, XLogP of 7.52, 23 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-fluorosulfonylsulfamoyl fluoride;methyl(trioctyl)azanium is sourced from PubChem (CID 175511644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).