About methyl-tri(nonyl)azanium iodide
methyl-tri(nonyl)azanium iodide (PubChem CID 88652767) has the molecular formula C28H60IN
and a molecular weight of 537.70 g/mol. Its IUPAC name is methyl-tri(nonyl)azanium iodide.
Molecular Properties
| Compound Name | methyl-tri(nonyl)azanium iodide |
| PubChem CID | 88652767 |
| Molecular Formula | C28H60IN |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.38 |
| IUPAC Name | methyl-tri(nonyl)azanium iodide |
| SMILES | CCCCCCCCC[N+](C)(CCCCCCCCC)CCCCCCCCC.[I-] |
| InChI | InChI=1S/C28H60N.HI/c1-5-8-11-14-17-20-23-26-29(4,27-24-21-18-15-12-9-6-2)28-25-22-19-16-13-10-7-3;/h5-28H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | GROGTSMERVNGLC-UHFFFAOYSA-M |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze methyl-tri(nonyl)azanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-tri(nonyl)azanium iodide?
The IUPAC name of methyl-tri(nonyl)azanium iodide (CID 88652767) is methyl-tri(nonyl)azanium iodide.
What is the SMILES notation for methyl-tri(nonyl)azanium iodide?
The canonical SMILES for methyl-tri(nonyl)azanium iodide is CCCCCCCCC[N+](C)(CCCCCCCCC)CCCCCCCCC.[I-].
What is the InChIKey of methyl-tri(nonyl)azanium iodide?
The InChIKey is GROGTSMERVNGLC-UHFFFAOYSA-M. The full InChI is InChI=1S/C28H60N.HI/c1-5-8-11-14-17-20-23-26-29(4,27-24-21-18-15-12-9-6-2)28-25-22-19-16-13-10-7-3;/h5-28H2,1-4H3;1H/q+1;/p-1.
What are the key properties of methyl-tri(nonyl)azanium iodide?
methyl-tri(nonyl)azanium iodide has a molecular weight of 537.70 g/mol, XLogP of 6.69, 24 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-tri(nonyl)azanium iodide is sourced from PubChem (CID 88652767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).