About trihexyl(methyl)azanium iodide
trihexyl(methyl)azanium iodide (PubChem CID 87252050) has the molecular formula C19H42IN
and a molecular weight of 411.46 g/mol. Its IUPAC name is trihexyl(methyl)azanium iodide.
Molecular Properties
| Compound Name | trihexyl(methyl)azanium iodide |
| PubChem CID | 87252050 |
| Molecular Formula | C19H42IN |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | trihexyl(methyl)azanium iodide |
| SMILES | CCCCCC[N+](C)(CCCCCC)CCCCCC.[I-] |
| InChI | InChI=1S/C19H42N.HI/c1-5-8-11-14-17-20(4,18-15-12-9-6-2)19-16-13-10-7-3;/h5-19H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | VDBXZRFWNFJHFT-UHFFFAOYSA-M |
| XLogP | 3.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trihexyl(methyl)azanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trihexyl(methyl)azanium iodide?
The IUPAC name of trihexyl(methyl)azanium iodide (CID 87252050) is trihexyl(methyl)azanium iodide.
What is the SMILES notation for trihexyl(methyl)azanium iodide?
The canonical SMILES for trihexyl(methyl)azanium iodide is CCCCCC[N+](C)(CCCCCC)CCCCCC.[I-].
What is the InChIKey of trihexyl(methyl)azanium iodide?
The InChIKey is VDBXZRFWNFJHFT-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H42N.HI/c1-5-8-11-14-17-20(4,18-15-12-9-6-2)19-16-13-10-7-3;/h5-19H2,1-4H3;1H/q+1;/p-1.
What are the key properties of trihexyl(methyl)azanium iodide?
trihexyl(methyl)azanium iodide has a molecular weight of 411.46 g/mol, XLogP of 3.18, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trihexyl(methyl)azanium iodide is sourced from PubChem (CID 87252050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).