About triheptyl(methyl)azanium hydroxide
triheptyl(methyl)azanium hydroxide (PubChem CID 87534234) has the molecular formula C22H49NO
and a molecular weight of 343.64 g/mol. Its IUPAC name is triheptyl(methyl)azanium hydroxide.
Molecular Properties
| Compound Name | triheptyl(methyl)azanium hydroxide |
| PubChem CID | 87534234 |
| Molecular Formula | C22H49NO |
| Molecular Weight | 343.64 g/mol |
| Exact Mass | 343.38 |
| IUPAC Name | triheptyl(methyl)azanium hydroxide |
| SMILES | CCCCCCC[N+](C)(CCCCCCC)CCCCCCC.[OH-] |
| InChI | InChI=1S/C22H48N.H2O/c1-5-8-11-14-17-20-23(4,21-18-15-12-9-6-2)22-19-16-13-10-7-3;/h5-22H2,1-4H3;1H2/q+1;/p-1 |
| InChIKey | SBMUUHKCUUPLIB-UHFFFAOYSA-M |
| XLogP | 7.17 |
| TPSA | 30.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.64 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triheptyl(methyl)azanium hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triheptyl(methyl)azanium hydroxide?
The IUPAC name of triheptyl(methyl)azanium hydroxide (CID 87534234) is triheptyl(methyl)azanium hydroxide.
What is the SMILES notation for triheptyl(methyl)azanium hydroxide?
The canonical SMILES for triheptyl(methyl)azanium hydroxide is CCCCCCC[N+](C)(CCCCCCC)CCCCCCC.[OH-].
What is the InChIKey of triheptyl(methyl)azanium hydroxide?
The InChIKey is SBMUUHKCUUPLIB-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H48N.H2O/c1-5-8-11-14-17-20-23(4,21-18-15-12-9-6-2)22-19-16-13-10-7-3;/h5-22H2,1-4H3;1H2/q+1;/p-1.
What are the key properties of triheptyl(methyl)azanium hydroxide?
triheptyl(methyl)azanium hydroxide has a molecular weight of 343.64 g/mol, XLogP of 7.17, 18 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triheptyl(methyl)azanium hydroxide is sourced from PubChem (CID 87534234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).