About methyl(trioctyl)azanium;chloride;hydrochloride
methyl(trioctyl)azanium;chloride;hydrochloride (PubChem CID 172818491) has the molecular formula C25H55Cl2N
and a molecular weight of 440.63 g/mol. Its IUPAC name is methyl(trioctyl)azanium;chloride;hydrochloride.
Molecular Properties
| Compound Name | methyl(trioctyl)azanium;chloride;hydrochloride |
| PubChem CID | 172818491 |
| Molecular Formula | C25H55Cl2N |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 439.37 |
| IUPAC Name | methyl(trioctyl)azanium;chloride;hydrochloride |
| SMILES | CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC.Cl.[Cl-] |
| InChI | InChI=1S/C25H54N.2ClH/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;;/h5-25H2,1-4H3;2*1H/q+1;;/p-1 |
| InChIKey | ZLIBLYQDEFQGNL-UHFFFAOYSA-M |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze methyl(trioctyl)azanium;chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl(trioctyl)azanium;chloride;hydrochloride?
The IUPAC name of methyl(trioctyl)azanium;chloride;hydrochloride (CID 172818491) is methyl(trioctyl)azanium;chloride;hydrochloride.
What is the SMILES notation for methyl(trioctyl)azanium;chloride;hydrochloride?
The canonical SMILES for methyl(trioctyl)azanium;chloride;hydrochloride is CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC.Cl.[Cl-].
What is the InChIKey of methyl(trioctyl)azanium;chloride;hydrochloride?
The InChIKey is ZLIBLYQDEFQGNL-UHFFFAOYSA-M. The full InChI is InChI=1S/C25H54N.2ClH/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;;/h5-25H2,1-4H3;2*1H/q+1;;/p-1.
What are the key properties of methyl(trioctyl)azanium;chloride;hydrochloride?
methyl(trioctyl)azanium;chloride;hydrochloride has a molecular weight of 440.63 g/mol, XLogP of 5.94, 21 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl(trioctyl)azanium;chloride;hydrochloride is sourced from PubChem (CID 172818491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).