About potassium N-fluorosulfonylsulfamoyl fluoride
potassium N-fluorosulfonylsulfamoyl fluoride (PubChem CID 173005771) has the molecular formula HF2KNO4S2+
and a molecular weight of 220.24 g/mol. Its IUPAC name is potassium N-fluorosulfonylsulfamoyl fluoride.
Molecular Properties
| Compound Name | potassium N-fluorosulfonylsulfamoyl fluoride |
| PubChem CID | 173005771 |
| Molecular Formula | HF2KNO4S2+ |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 219.89 |
| IUPAC Name | potassium N-fluorosulfonylsulfamoyl fluoride |
| SMILES | O=S(=O)(F)NS(=O)(=O)F.[K+] |
| InChI | InChI=1S/F2HNO4S2.K/c1-8(4,5)3-9(2,6)7;/h3H;/q;+1 |
| InChIKey | UVBQRDMUFOXHDF-UHFFFAOYSA-N |
| XLogP | -3.99 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | -3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze potassium N-fluorosulfonylsulfamoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium N-fluorosulfonylsulfamoyl fluoride?
The IUPAC name of potassium N-fluorosulfonylsulfamoyl fluoride (CID 173005771) is potassium N-fluorosulfonylsulfamoyl fluoride.
What is the SMILES notation for potassium N-fluorosulfonylsulfamoyl fluoride?
The canonical SMILES for potassium N-fluorosulfonylsulfamoyl fluoride is O=S(=O)(F)NS(=O)(=O)F.[K+].
What is the InChIKey of potassium N-fluorosulfonylsulfamoyl fluoride?
The InChIKey is UVBQRDMUFOXHDF-UHFFFAOYSA-N. The full InChI is InChI=1S/F2HNO4S2.K/c1-8(4,5)3-9(2,6)7;/h3H;/q;+1.
What are the key properties of potassium N-fluorosulfonylsulfamoyl fluoride?
potassium N-fluorosulfonylsulfamoyl fluoride has a molecular weight of 220.24 g/mol, XLogP of -3.99, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium N-fluorosulfonylsulfamoyl fluoride is sourced from PubChem (CID 173005771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).