N-(fluorosulfonimidoyl)sulfamoyl fluoride

H2F2N2O3S2 — CID 163907553

IUPACN-(fluorosulfonimidoyl)sulfamoyl fluoride
SMILES[H]N=S(=O)(F)NS(=O)(=O)F
InChIInChI=1S/F2H2N2O3S2/c1-8(3,5)4-9(2,6)7/h(H2,3,4,5)
InChIKeyQPHKXZOQQPFQFW-UHFFFAOYSA-N
MW180.16 g/mol
LogP-0.36
Rot. Bonds2

About N-(fluorosulfonimidoyl)sulfamoyl fluoride

N-(fluorosulfonimidoyl)sulfamoyl fluoride (PubChem CID 163907553) has the molecular formula H2F2N2O3S2 and a molecular weight of 180.16 g/mol. Its IUPAC name is N-(fluorosulfonimidoyl)sulfamoyl fluoride.

Molecular Properties

Compound NameN-(fluorosulfonimidoyl)sulfamoyl fluoride
PubChem CID163907553
Molecular FormulaH2F2N2O3S2
Molecular Weight180.16 g/mol
Exact Mass179.95
IUPAC NameN-(fluorosulfonimidoyl)sulfamoyl fluoride
SMILES[H]N=S(=O)(F)NS(=O)(=O)F
InChIInChI=1S/F2H2N2O3S2/c1-8(3,5)4-9(2,6)7/h(H2,3,4,5)
InChIKeyQPHKXZOQQPFQFW-UHFFFAOYSA-N
XLogP-0.36
TPSA87.09 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.16
LogP ≤ 5-0.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze N-(fluorosulfonimidoyl)sulfamoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(fluorosulfonimidoyl)sulfamoyl fluoride?
The IUPAC name of N-(fluorosulfonimidoyl)sulfamoyl fluoride (CID 163907553) is N-(fluorosulfonimidoyl)sulfamoyl fluoride.
What is the SMILES notation for N-(fluorosulfonimidoyl)sulfamoyl fluoride?
The canonical SMILES for N-(fluorosulfonimidoyl)sulfamoyl fluoride is [H]N=S(=O)(F)NS(=O)(=O)F.
What is the InChIKey of N-(fluorosulfonimidoyl)sulfamoyl fluoride?
The InChIKey is QPHKXZOQQPFQFW-UHFFFAOYSA-N. The full InChI is InChI=1S/F2H2N2O3S2/c1-8(3,5)4-9(2,6)7/h(H2,3,4,5).
What are the key properties of N-(fluorosulfonimidoyl)sulfamoyl fluoride?
N-(fluorosulfonimidoyl)sulfamoyl fluoride has a molecular weight of 180.16 g/mol, XLogP of -0.36, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(fluorosulfonimidoyl)sulfamoyl fluoride is sourced from PubChem (CID 163907553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).