C13H29NO2S — CID 58058792
N,N-dibutyl-4-methylsulfonylbutan-1-amine (PubChem CID 58058792) has the molecular formula C13H29NO2S and a molecular weight of 263.45 g/mol. Its IUPAC name is N,N-dibutyl-4-methylsulfonylbutan-1-amine.
| Compound Name | N,N-dibutyl-4-methylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 58058792 |
| Molecular Formula | C13H29NO2S |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N,N-dibutyl-4-methylsulfonylbutan-1-amine |
| SMILES | CCCCN(CCCC)CCCCS(C)(=O)=O |
| InChI | InChI=1S/C13H29NO2S/c1-4-6-10-14(11-7-5-2)12-8-9-13-17(3,15)16/h4-13H2,1-3H3 |
| InChIKey | ZHYYIOYTQXBZLL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|