C24H46F6N2O4S2 — CID 172841939
1-hexadecyl-3-methylpiperidine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 172841939) has the molecular formula C24H46F6N2O4S2 and a molecular weight of 604.76 g/mol. Its IUPAC name is 1-hexadecyl-3-methylpiperidine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | 1-hexadecyl-3-methylpiperidine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 172841939 |
| Molecular Formula | C24H46F6N2O4S2 |
| Molecular Weight | 604.76 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | 1-hexadecyl-3-methylpiperidine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CCCCCCCCCCCCCCCCN1CCCC(C)C1.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H45N.C2HF6NO4S2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-23-20-17-18-22(2)21-23;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h22H,3-21H2,1-2H3;9H |
| InChIKey | WXERRNYKLBXCKR-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.76 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|