C27H34N2O2 — CID 171034868
6-(tritylamino)hexylazanium acetate (PubChem CID 171034868) has the molecular formula C27H34N2O2 and a molecular weight of 418.58 g/mol. Its IUPAC name is 6-(tritylamino)hexylazanium acetate.
| Compound Name | 6-(tritylamino)hexylazanium acetate |
|---|---|
| PubChem CID | 171034868 |
| Molecular Formula | C27H34N2O2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 6-(tritylamino)hexylazanium acetate |
| SMILES | CC(=O)[O-].[NH3+]CCCCCCNC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H30N2.C2H4O2/c26-20-12-1-2-13-21-27-25(22-14-6-3-7-15-22,23-16-8-4-9-17-23)24-18-10-5-11-19-24;1-2(3)4/h3-11,14-19,27H,1-2,12-13,20-21,26H2;1H3,(H,3,4) |
| InChIKey | DTBUBVPQHYKPPS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|