C38H53N3O4 — CID 101096516
tert-butyl N-ethyl-N-[4-[(2-methylpropan-2-yl)oxycarbonyl-[3-(tritylamino)propyl]amino]butyl]carbamate (PubChem CID 101096516) has the molecular formula C38H53N3O4 and a molecular weight of 615.86 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[4-[(2-methylpropan-2-yl)oxycarbonyl-[3-(tritylamino)propyl]amino]butyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[4-[(2-methylpropan-2-yl)oxycarbonyl-[3-(tritylamino)propyl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 101096516 |
| Molecular Formula | C38H53N3O4 |
| Molecular Weight | 615.86 g/mol |
| Exact Mass | 615.40 |
| IUPAC Name | tert-butyl N-ethyl-N-[4-[(2-methylpropan-2-yl)oxycarbonyl-[3-(tritylamino)propyl]amino]butyl]carbamate |
| SMILES | CCN(CCCCN(CCCNC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H53N3O4/c1-8-40(34(42)44-36(2,3)4)28-18-19-29-41(35(43)45-37(5,6)7)30-20-27-39-38(31-21-12-9-13-22-31,32-23-14-10-15-24-32)33-25-16-11-17-26-33/h9-17,21-26,39H,8,18-20,27-30H2,1-7H3 |
| InChIKey | LBXXSOWOMWSBFX-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.86 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|