C18H29FN2O2 — CID 107242692
tert-butyl N-ethyl-N-[3-[1-(2-fluorophenyl)ethylamino]propyl]carbamate (PubChem CID 107242692) has the molecular formula C18H29FN2O2 and a molecular weight of 324.44 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[3-[1-(2-fluorophenyl)ethylamino]propyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[3-[1-(2-fluorophenyl)ethylamino]propyl]carbamate |
|---|---|
| PubChem CID | 107242692 |
| Molecular Formula | C18H29FN2O2 |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | tert-butyl N-ethyl-N-[3-[1-(2-fluorophenyl)ethylamino]propyl]carbamate |
| SMILES | CCN(CCCNC(C)c1ccccc1F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29FN2O2/c1-6-21(17(22)23-18(3,4)5)13-9-12-20-14(2)15-10-7-8-11-16(15)19/h7-8,10-11,14,20H,6,9,12-13H2,1-5H3 |
| InChIKey | RMIUTSZKJPITKX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|