C14H21FN2O — CID 81380915
4-[[(1R)-1-(2-fluorophenyl)ethyl]amino]-N,N-dimethylbutanamide (PubChem CID 81380915) has the molecular formula C14H21FN2O and a molecular weight of 252.33 g/mol. Its IUPAC name is 4-[[(1R)-1-(2-fluorophenyl)ethyl]amino]-N,N-dimethylbutanamide.
| Compound Name | 4-[[(1R)-1-(2-fluorophenyl)ethyl]amino]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 81380915 |
| Molecular Formula | C14H21FN2O |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 4-[[(1R)-1-(2-fluorophenyl)ethyl]amino]-N,N-dimethylbutanamide |
| SMILES | C[C@@H](NCCCC(=O)N(C)C)c1ccccc1F |
| InChI | InChI=1S/C14H21FN2O/c1-11(12-7-4-5-8-13(12)15)16-10-6-9-14(18)17(2)3/h4-5,7-8,11,16H,6,9-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | ROCAQJBMZATECA-LLVKDONJSA-N |
| XLogP | 2.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|