C13H17FN2 — CID 81380757
5-[[(1R)-1-(2-fluorophenyl)ethyl]amino]pentanenitrile (PubChem CID 81380757) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is 5-[[(1R)-1-(2-fluorophenyl)ethyl]amino]pentanenitrile.
| Compound Name | 5-[[(1R)-1-(2-fluorophenyl)ethyl]amino]pentanenitrile |
|---|---|
| PubChem CID | 81380757 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 5-[[(1R)-1-(2-fluorophenyl)ethyl]amino]pentanenitrile |
| SMILES | C[C@@H](NCCCCC#N)c1ccccc1F |
| InChI | InChI=1S/C13H17FN2/c1-11(16-10-6-2-5-9-15)12-7-3-4-8-13(12)14/h3-4,7-8,11,16H,2,5-6,10H2,1H3/t11-/m1/s1 |
| InChIKey | GCPZYJAGXBOLGV-LLVKDONJSA-N |
| XLogP | 3.17 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|