C15H32N2O4S — CID 103913902
tert-butyl N-ethyl-N-[3-(1-ethylsulfonylpropan-2-ylamino)propyl]carbamate (PubChem CID 103913902) has the molecular formula C15H32N2O4S and a molecular weight of 336.50 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[3-(1-ethylsulfonylpropan-2-ylamino)propyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[3-(1-ethylsulfonylpropan-2-ylamino)propyl]carbamate |
|---|---|
| PubChem CID | 103913902 |
| Molecular Formula | C15H32N2O4S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | tert-butyl N-ethyl-N-[3-(1-ethylsulfonylpropan-2-ylamino)propyl]carbamate |
| SMILES | CCN(CCCNC(C)CS(=O)(=O)CC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H32N2O4S/c1-7-17(14(18)21-15(4,5)6)11-9-10-16-13(3)12-22(19,20)8-2/h13,16H,7-12H2,1-6H3 |
| InChIKey | JQZFHFMAIIUBIF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|