About methyl 2-(tritylamino)acetate
methyl 2-(tritylamino)acetate (PubChem CID 637611) has the molecular formula C22H21NO2
and a molecular weight of 331.42 g/mol. Its IUPAC name is methyl 2-(tritylamino)acetate.
Molecular Properties
| Compound Name | methyl 2-(tritylamino)acetate |
| PubChem CID | 637611 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | methyl 2-(tritylamino)acetate |
| SMILES | COC(=O)CNC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21NO2/c1-25-21(24)17-23-22(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,23H,17H2,1H3 |
| InChIKey | QFCOXPSJQAJMPM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(tritylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(tritylamino)acetate?
The IUPAC name of methyl 2-(tritylamino)acetate (CID 637611) is methyl 2-(tritylamino)acetate.
What is the SMILES notation for methyl 2-(tritylamino)acetate?
The canonical SMILES for methyl 2-(tritylamino)acetate is COC(=O)CNC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 2-(tritylamino)acetate?
The InChIKey is QFCOXPSJQAJMPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO2/c1-25-21(24)17-23-22(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,23H,17H2,1H3.
What are the key properties of methyl 2-(tritylamino)acetate?
methyl 2-(tritylamino)acetate has a molecular weight of 331.42 g/mol, XLogP of 3.74, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(tritylamino)acetate is sourced from PubChem (CID 637611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).